Potassium 2-isonicotinoyltrifluoroborate structure
|
Common Name | Potassium 2-isonicotinoyltrifluoroborate | ||
|---|---|---|---|---|
| CAS Number | 1622923-53-8 | Molecular Weight | 213.01 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H4BF3KNO | Melting Point | 239-244°C | |
| MSDS | USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Potassium 2-isonicotinoyltrifluoroborate |
|---|
| Melting Point | 239-244°C |
|---|---|
| Molecular Formula | C6H4BF3KNO |
| Molecular Weight | 213.01 |
| Appearance of Characters | powder |
| InChIKey | VIIUKPRLRKCRIS-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccn1)[B-](F)(F)F.[K+] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P280-P304 + P340 + P312-P305 + P351 + P338-P337 + P313 |
| RIDADR | NONH for all modes of transport |