TAK-020 structure
|
Common Name | TAK-020 | ||
|---|---|---|---|---|
| CAS Number | 1627603-21-7 | Molecular Weight | 351.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H17N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TAK-020TAK-020 is a covalent Btk inhibitor, which becomes the clinical candidate. |
| Name | TAK-020 |
|---|
| Description | TAK-020 is a covalent Btk inhibitor, which becomes the clinical candidate. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C18H17N5O3 |
|---|---|
| Molecular Weight | 351.36 |
| InChIKey | HIMUHMBGRATXMK-LBPRGKRZSA-N |
| SMILES | C=CC(=O)N1CCC(Oc2nc(-c3n[nH]c(=O)[nH]3)cc3ccccc23)C1 |