MLK-IN-1 structure
|
Common Name | MLK-IN-1 | ||
|---|---|---|---|---|
| CAS Number | 1627729-62-7 | Molecular Weight | 432.49 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H20N4O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MLK-IN-1MLK-IN-1 is a potent, brain penetrant and specific mixed lineage kinase 3 (MLK-3) inhibitor, compound 68, extracted from patent US20140256733A1[1]. |
| Name | MLK-IN-1 |
|---|
| Description | MLK-IN-1 is a potent, brain penetrant and specific mixed lineage kinase 3 (MLK-3) inhibitor, compound 68, extracted from patent US20140256733A1[1]. |
|---|---|
| Related Catalog | |
| Target |
MLK3 |
| In Vitro | MLK-IN-1 (100 nM; pre-treatment 20 mins HIV-1 Tat) promotes continued axonogenesis in the presence of Tat-activated microglia and protects against effects of HIV-Tat in vitro[1]. |
| References |
| Molecular Formula | C23H20N4O3S |
|---|---|
| Molecular Weight | 432.49 |
| InChIKey | NTIXYCZKSHEEOH-UHFFFAOYSA-N |
| SMILES | COc1ccc(Nc2ccc3ncc(-c4cc5cccc(OC)c5s4)n3n2)cc1OC |