2-Hydroxy atorvastatin lactone structure
|
Common Name | 2-Hydroxy atorvastatin lactone | ||
|---|---|---|---|---|
| CAS Number | 163217-74-1 | Molecular Weight | 556.62400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H33FN2O5 | Melting Point | 110-112ºC | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2-Hydroxy atorvastatin lactone2-Hydroxy atorvastatin lactone is a metabolite of Atorvastatin. Atorvastatin is an orally active HMG-CoA reductase inhibitor, has the ability to effectively decrease blood lipids[1][2]. |
| Name | 2-Hydroxy Atorvastatin Lactone |
|---|---|
| Synonym | More Synonyms |
| Description | 2-Hydroxy atorvastatin lactone is a metabolite of Atorvastatin. Atorvastatin is an orally active HMG-CoA reductase inhibitor, has the ability to effectively decrease blood lipids[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Melting Point | 110-112ºC |
|---|---|
| Molecular Formula | C33H33FN2O5 |
| Molecular Weight | 556.62400 |
| Exact Mass | 556.23700 |
| PSA | 100.79000 |
| LogP | 6.57210 |
| InChIKey | MNECBMZJZFGTIK-JWQCQUIFSA-N |
| SMILES | CC(C)c1c(C(=O)Nc2ccccc2O)c(-c2ccccc2)c(-c2ccc(F)cc2)n1CCC1CC(O)CC(=O)O1 |
| 5-(4-fluorophenyl)-1-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-N-(2-hydroxyphenyl)-4-phenyl-2-propan-2-ylpyrrole-3-carboxamide |