(R)-(-)-N-(1-(1-NAPHTHYL)ETHYL)PHTHALAMI C ACID structure
|
Common Name | (R)-(-)-N-(1-(1-NAPHTHYL)ETHYL)PHTHALAMI C ACID | ||
|---|---|---|---|---|
| CAS Number | 163438-05-9 | Molecular Weight | 319.35400 | |
| Density | 1.255g/cm3 | Boiling Point | 582ºC at 760mmHg | |
| Molecular Formula | C20H17NO3 | Melting Point | 166ºC (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 305.8ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-[[(1R)-1-naphthalen-1-ylethyl]carbamoyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.255g/cm3 |
|---|---|
| Boiling Point | 582ºC at 760mmHg |
| Melting Point | 166ºC (dec.)(lit.) |
| Molecular Formula | C20H17NO3 |
| Molecular Weight | 319.35400 |
| Flash Point | 305.8ºC |
| Exact Mass | 319.12100 |
| PSA | 69.89000 |
| LogP | 4.60380 |
| Vapour Pressure | 2.18E-14mmHg at 25°C |
| Index of Refraction | 1.658 |
| InChIKey | ZEKKAEAOTSMLNW-CYBMUJFWSA-N |
| SMILES | CC(NC(=O)c1ccccc1C(=O)O)c1cccc2ccccc12 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| MFCD00192338 |
| (R)-(-)-N-[1-(1-Naphthyl)ethyl]phthalamic acid |