MC-VC-PAB-Tubulysin M
Modify Date: 2025-08-25 19:10:34
MC-VC-PAB-Tubulysin M structure
|
Common Name | MC-VC-PAB-Tubulysin M | ||
|---|---|---|---|---|
| CAS Number | 1639939-56-2 | Molecular Weight | 1312.57 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C66H93N11O15S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MC-VC-PAB-Tubulysin MMC-vc-PAB-Tubulysin M consists a cleavable ADC linker (MC-vc-PAB) and a cytotoxic tubulin inhibitor Tubulysin M (HY-N7053). Tubulysin M is a cytotoxic activity tubulysin which inhibits tubulin polymerization and leads to cell cycle arrest and apoptosis[1]. |
| Name | MC-VC-PAB-Tubulysin M |
|---|
| Description | MC-vc-PAB-Tubulysin M consists a cleavable ADC linker (MC-vc-PAB) and a cytotoxic tubulin inhibitor Tubulysin M (HY-N7053). Tubulysin M is a cytotoxic activity tubulysin which inhibits tubulin polymerization and leads to cell cycle arrest and apoptosis[1]. |
|---|---|
| Related Catalog | |
| Target |
Auristatin |
| References |
| Molecular Formula | C66H93N11O15S |
|---|---|
| Molecular Weight | 1312.57 |
| InChIKey | RIMZNVUCGMFJGP-KCYCJFSYSA-N |
| SMILES | CCC(C)C(NC(=O)C1CCCCN1C(=O)OCc1ccc(NC(=O)C(CCCNC(N)=O)NC(=O)C(NC(=O)CCCCCN2C(=O)C=CC2=O)C(C)C)cc1)C(=O)N(C)C(CC(OC(C)=O)c1nc(C(=O)NC(Cc2ccccc2)CC(C)C(=O)O)cs1)C(C)C |
| Hazard Codes | Xi |
|---|