3,3'-Dibromobiphenyl structure
|
Common Name | 3,3'-Dibromobiphenyl | ||
|---|---|---|---|---|
| CAS Number | 16400-51-4 | Molecular Weight | 312.000 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 338.6±17.0 °C at 760 mmHg | |
| Molecular Formula | C12H8Br2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.3±20.2 °C | |
| Name | 3,3'-Dibromo-1,1'-biphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 338.6±17.0 °C at 760 mmHg |
| Molecular Formula | C12H8Br2 |
| Molecular Weight | 312.000 |
| Flash Point | 184.3±20.2 °C |
| Exact Mass | 309.899261 |
| LogP | 5.33 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | LPLLWKZDMKTEMV-UHFFFAOYSA-N |
| SMILES | Brc1cccc(-c2cccc(Br)c2)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2903999010 |
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2903999010 |
|---|---|
| Summary | 2903999010 2,3,3',4,5,6-hexachloro-1,1'-biphenyl。supervision conditions:89(articles on the list of prohibited export goods,articles on the list of prohibited import goods)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:5.5%。general tariff:30.0% |
| 1,1'-Biphenyl, 3,3'-dibromo- |
| 1-bromo-3-(3-bromophenyl)benzene |
| 3,3'-Dibromobiphenyl |
| 3,3'-Dibromo-1,1'-biphenyl |