MEXENONE structure
|
Common Name | MEXENONE | ||
|---|---|---|---|---|
| CAS Number | 1641-17-4 | Molecular Weight | 242.270 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 400.1±35.0 °C at 760 mmHg | |
| Molecular Formula | C15H14O3 | Melting Point | 99-102°C | |
| MSDS | N/A | Flash Point | 150.2±19.4 °C | |
Use of MEXENONEMexenone is a benzophenone-derived sunscreening agent. |
| Name | (2-hydroxy-4-methoxyphenyl)-(4-methylphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Description | Mexenone is a benzophenone-derived sunscreening agent. |
|---|---|
| Related Catalog |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 400.1±35.0 °C at 760 mmHg |
| Melting Point | 99-102°C |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.270 |
| Flash Point | 150.2±19.4 °C |
| Exact Mass | 242.094299 |
| PSA | 46.53000 |
| LogP | 4.10 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | MJVGBKJNTFCUJM-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)c2ccc(C)cc2)c(O)c1 |
| Storage condition | -20℃ |
|
~82%
MEXENONE CAS#:1641-17-4 |
| Literature: Tetrahedron, , vol. 42, # 3 p. 885 - 892 |
|
~32%
MEXENONE CAS#:1641-17-4 |
| Literature: Tetrahedron Letters, , vol. 41, # 49 p. 9667 - 9671 |
|
~%
MEXENONE CAS#:1641-17-4 |
| Literature: Tetrahedron Letters, , vol. 41, # 49 p. 9667 - 9671 |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| mexenone |
| benzophenone-10 |
| (2-Hydroxy-4-methoxyphenyl)(4-methylphenyl)methanone |
| 2-hydroxy-4'-methyl-4-methoxy-benzophenone |
| MFCD00017172 |
| Uvistat |
| EINECS 216-688-2 |
| 2-HYDROXY-4-METHOXY-4'-METHYLBENZOPHENONE |