7-chloro-5-(2-fluorophenyl)-1H-benzo[e][1,4]diazepine-2(3H)-thione structure
|
Common Name | 7-chloro-5-(2-fluorophenyl)-1H-benzo[e][1,4]diazepine-2(3H)-thione | ||
|---|---|---|---|---|
| CAS Number | 1645-32-5 | Molecular Weight | 304.77000 | |
| Density | 1.39g/cm3 | Boiling Point | 410.2ºC at 760mmHg | |
| Molecular Formula | C15H10ClFN2S | Melting Point | 212-214 °C | |
| MSDS | N/A | Flash Point | 201.9ºC | |
| Name | 7-chloro-5-(2-fluorophenyl)-1,3-dihydro-1,4-benzodiazepine-2-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 410.2ºC at 760mmHg |
| Melting Point | 212-214 °C |
| Molecular Formula | C15H10ClFN2S |
| Molecular Weight | 304.77000 |
| Flash Point | 201.9ºC |
| Exact Mass | 304.02400 |
| PSA | 63.52000 |
| LogP | 3.16110 |
| Vapour Pressure | 6.12E-07mmHg at 25°C |
| Index of Refraction | 1.671 |
| InChIKey | UAFWJQYZZIJGPD-UHFFFAOYSA-N |
| SMILES | Fc1ccccc1C1=NCC(=S)Nc2ccc(Cl)cc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-Desmethylquazepam |
| 7-chloro-1,3-dihydro-5-(2-fluorophenyl)-2H-1,4-benzodiazepine-2-thione |
| 7-Chlor-5-<2-fluor-phenyl>-1.3-dihydro-2H-1.4-benzodiazepin-2-thion |
| 1,3-Dihydro-5-(o-fluorphenyl)-7-chlor-2H-1,4-benzodiazepin-2-thion |
| 7-chloro-5-(2-fluoro-phenyl)-1,3-dihydro-benzo[e][1,4]diazepine-2-thione |
| 7-chloro-5-(2-fluorophenyl)-3H-1,4-benzodiazepine-2(1H)-thione |
| 7-chloro-5-(2-fluorophenyl)-1,3-dihydro-2H-1,4-benzodiazepine-2-thione |
| 2H-1,4-Benzodiazepine-2-thione,7-chloro-5-(2-fluorophenyl)-1,3-dihydro |
| 7-chloro-1,3-dihydro-5-(o-fluorophenyl)-2H-1,4-benzodiazepine-2-thione |