2-chloro-N-[4-chloro-2-(2-fluorobenzoyl)phenyl]acetamide structure
|
Common Name | 2-chloro-N-[4-chloro-2-(2-fluorobenzoyl)phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 2836-40-0 | Molecular Weight | 326.15000 | |
| Density | 1.429g/cm3 | Boiling Point | 565.7ºC at 760mmHg | |
| Molecular Formula | C15H10Cl2FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 296ºC | |
| Name | 2-chloro-N-[4-chloro-2-(2-fluorobenzoyl)phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.429g/cm3 |
|---|---|
| Boiling Point | 565.7ºC at 760mmHg |
| Molecular Formula | C15H10Cl2FNO2 |
| Molecular Weight | 326.15000 |
| Flash Point | 296ºC |
| Exact Mass | 325.00700 |
| PSA | 46.17000 |
| LogP | 3.96040 |
| Vapour Pressure | 8.07E-13mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | JXGJTLQYJCMHKX-UHFFFAOYSA-N |
| SMILES | O=C(CCl)Nc1ccc(Cl)cc1C(=O)c1ccccc1F |
| HS Code | 2924299090 |
|---|
|
~%
2-chloro-N-[4-c... CAS#:2836-40-0 |
| Literature: Cheng, Pi; Zhang, Quan; Ma, Yun-Bao; Jiang, Zhi-Yong; Zhang, Xue-Mei; Zhang, Feng-Xue; Chen, Ji-Jun Bioorganic and Medicinal Chemistry Letters, 2008 , vol. 18, # 13 p. 3787 - 3789 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Chloracetamino-5-chlor-2'-fluor-benzophenon |
| EINECS 220-625-4 |
| 2-Chloracetamido-5-chlor-2'-fluorbenzophenon |
| 2-chloroacetamido-5-chloro-2'-fluorobenzophenone |
| 2-Chloracetylamino-5-chlor-2'-fluor-benzophenon |
| 2-Chloro-N-(4-chloro-2-(2-fluorobenzoyl)phenyl)acetamide |
| 2-(2-chloroacetyl)amino-4-chloro-2'-fluorobenzophenone |