2-Amino-5-chloro-2'-fluorobenzophenone structure
|
Common Name | 2-Amino-5-chloro-2'-fluorobenzophenone | ||
|---|---|---|---|---|
| CAS Number | 784-38-3 | Molecular Weight | 249.668 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 432.2±45.0 °C at 760 mmHg | |
| Molecular Formula | C13H9ClFNO | Melting Point | 95-98 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 215.2±28.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Amino-5-chloro-2'-fluorobenzophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 432.2±45.0 °C at 760 mmHg |
| Melting Point | 95-98 °C(lit.) |
| Molecular Formula | C13H9ClFNO |
| Molecular Weight | 249.668 |
| Flash Point | 215.2±28.7 °C |
| Exact Mass | 249.035675 |
| PSA | 43.09000 |
| LogP | 3.15 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | GTGMXPIQRQSORU-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Cl)cc1C(=O)c1ccccc1F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2922399090 |
|
~%
2-Amino-5-chlor... CAS#:784-38-3 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 38, # 3 p. 663 - 669 |
|
~%
2-Amino-5-chlor... CAS#:784-38-3 |
| Literature: Molecules, , vol. 16, # 9 p. 7649 - 7661 |
|
~%
2-Amino-5-chlor... CAS#:784-38-3 |
| Literature: Arzneimittel-Forschung/Drug Research, , vol. 32, # 3 p. 177 - 183 |
|
~%
2-Amino-5-chlor... CAS#:784-38-3 |
| Literature: Molecules, , vol. 16, # 9 p. 7649 - 7661 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Synthesis of the impurities during the manufacture of bulk drug midazolam and separation of these impurities by HPLC.
Acta. Pharm. 63(3) , 385-96, (2013) During the manufacture of bulk drug midazolam various impurities arised that can be the related products or degradation products. Structures of eight impurities that can arise during the manufacture o... |
|
|
J. Chem. Res. Synop. , 2, (1991)
|
|
|
J. Am. Chem. Soc. 112 , 3969, (1990)
|
| 2-Amino-5-chlorophenyl 2-fluorophenyl ketone |
| (2-amino-5-chlorophenyl)-(2-fluorophenyl)methanone |
| EINECS 212-316-8 |
| MFCD00038381 |
| ZR DG BVR BF |
| 2-Amino-5-chloro-2'-fluorobenzophenone |
| (2-Amino-5-chlorophenyl)(2-fluorophenyl)methanone |