4-(3-CHLORO-PHENOXY)-BENZALDEHYDE structure
|
Common Name | 4-(3-CHLORO-PHENOXY)-BENZALDEHYDE | ||
|---|---|---|---|---|
| CAS Number | 164522-90-1 | Molecular Weight | 232.66200 | |
| Density | 1.235 g/mL at 25ºC | Boiling Point | 350.272ºC at 760 mmHg | |
| Molecular Formula | C13H9ClO2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS07, GHS08 |
Signal Word | Danger | |
| Name | 4-(3-chlorophenoxy)benzaldehyde |
|---|
| Density | 1.235 g/mL at 25ºC |
|---|---|
| Boiling Point | 350.272ºC at 760 mmHg |
| Molecular Formula | C13H9ClO2 |
| Molecular Weight | 232.66200 |
| Flash Point | >230 °F |
| Exact Mass | 232.02900 |
| PSA | 26.30000 |
| LogP | 3.94480 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | n 20/D 1.619 |
| InChIKey | BGMYGFFWBQIXHN-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(Oc2cccc(Cl)c2)cc1 |
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H319-H334 |
| Precautionary Statements | P261-P305 + P351 + P338-P342 + P311 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn: Harmful;N: Dangerous for the environment; |
| Risk Phrases | R22 |
| Safety Phrases | S26 |
| RIDADR | UN 3077 9/PG 3 |
| HS Code | 2913000090 |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |