5-methyl-2-(4-nitrophenyl)-2H-pyrazol-3-ylamine structure
|
Common Name | 5-methyl-2-(4-nitrophenyl)-2H-pyrazol-3-ylamine | ||
|---|---|---|---|---|
| CAS Number | 16459-47-5 | Molecular Weight | 218.21200 | |
| Density | 1.42g/cm3 | Boiling Point | 421.6ºC at 760mmHg | |
| Molecular Formula | C10H10N4O2 | Melting Point | 159 °C | |
| MSDS | USA | Flash Point | 208.8ºC | |
| Name | 5-methyl-2-(4-nitrophenyl)pyrazol-3-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 421.6ºC at 760mmHg |
| Melting Point | 159 °C |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.21200 |
| Flash Point | 208.8ºC |
| Exact Mass | 218.08000 |
| PSA | 89.66000 |
| LogP | 2.77550 |
| Vapour Pressure | 2.57E-07mmHg at 25°C |
| Index of Refraction | 1.679 |
| InChIKey | TVXCGEBTCKIPNH-UHFFFAOYSA-N |
| SMILES | Cc1cc(N)n(-c2ccc([N+](=O)[O-])cc2)n1 |
| Water Solubility | insoluble |
| Hazard Codes | Xn |
|---|---|
| Risk Phrases | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed . R20/21:Harmful by inhalation and in contact with skin . |
| Safety Phrases | S36/37-S22 |
| WGK Germany | 3 |
| HS Code | 2933199090 |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-amino-1-(4-nitrophenyl)pyrazole |
| 5-amino-3-methyl-1-(4-nitrophenyl)-1H-pyrazole |
| MFCD00233473 |
| 3-methyl-1-(4-nitrophenyl)-1H-pyrazol-5-amine |
| 5-Methyl-2-(4-nitro-phenyl)-2H-pyrazol-3-ylamin |
| 5-methyl-2-(4-nitrophenyl)-2H-pyrazol-3-ylamine |