1,2,3,4,5-pentachloro-6-iodobenzene structure
|
Common Name | 1,2,3,4,5-pentachloro-6-iodobenzene | ||
|---|---|---|---|---|
| CAS Number | 16478-18-5 | Molecular Weight | 376.23400 | |
| Density | 2.196g/cm3 | Boiling Point | 356.8ºC at 760mmHg | |
| Molecular Formula | C6Cl5I | Melting Point | 215-217ºC | |
| MSDS | N/A | Flash Point | 169.6ºC | |
| Name | 1,2,3,4,5-pentachloro-6-iodobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.196g/cm3 |
|---|---|
| Boiling Point | 356.8ºC at 760mmHg |
| Melting Point | 215-217ºC |
| Molecular Formula | C6Cl5I |
| Molecular Weight | 376.23400 |
| Flash Point | 169.6ºC |
| Exact Mass | 373.74900 |
| LogP | 5.55820 |
| Vapour Pressure | 5.85E-05mmHg at 25°C |
| Index of Refraction | 1.665 |
| InChIKey | JUOZURBHPHLQGX-UHFFFAOYSA-N |
| SMILES | Clc1c(Cl)c(Cl)c(I)c(Cl)c1Cl |
| HS Code | 2903999090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| pentachloroiodobenzene |
| Pentachlor-jod-benzol |
| Pentachlor-iod-benzol |
| Iodopentachlorbenzol |
| 2,3,4,5,6-pentachloroiodobenzene |
| 2,3,4,5,6-pentachloro-6-iodobenzene |
| Benzene,pentachloroiodo |