Squalane-d62 structure
|
Common Name | Squalane-d62 | ||
|---|---|---|---|---|
| CAS Number | 16514-83-3 | Molecular Weight | 485.195 | |
| Density | 0.8±0.1 g/cm3 | Boiling Point | 470.3±0.0 °C at 760 mmHg | |
| Molecular Formula | C30D62 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.8±0.0 °C | |
Use of Squalane-d62Squalane-d62 is the deuterium labeled Squalane[1]. Squalane, found in certain fish oils (especially shark liver oil), and some vegetable oils, is a saturated derivative of Squalene. Squalane shows anticancer, antioxidant, skin hydrating, and emollient activities[2]. |
| Name | 2,6,10,15,19,23-hexamethyltetracosane-d62 |
|---|---|
| Synonym | More Synonyms |
| Description | Squalane-d62 is the deuterium labeled Squalane[1]. Squalane, found in certain fish oils (especially shark liver oil), and some vegetable oils, is a saturated derivative of Squalene. Squalane shows anticancer, antioxidant, skin hydrating, and emollient activities[2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Density | 0.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 470.3±0.0 °C at 760 mmHg |
| Molecular Formula | C30D62 |
| Molecular Weight | 485.195 |
| Flash Point | 217.8±0.0 °C |
| Exact Mass | 484.874298 |
| LogP | 15.59 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.448 |
| InChIKey | PRAKJMSDJKAYCZ-SMFALFTRSA-N |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCCC(C)CCCC(C)CCCC(C)C |
| Tetracosane-1,1,1,2,3,3,4,4,5,5,6,7,7,8,8,9,9,10,11,11,12,12,13,13,14,14,15,16,16,17,17,18,18,19,20,20,21,21,22,22,23,24,24,24-d, 2,6,10,15,19,23-hexa(methyl-d)- |
| dohexacontadeuterio-squalane |
| SQAFLFQPQRF-NH2 |
| 2,6,10,15,19,23-Hexakis[(H)methyl](H)tetracosane |
| 2H,6H,10H,15H,19H,23H-dotriacontadeuterio-2,6,10,15,19,23-hexakis-trideuteriomethyl-tetracosane |
| H-SER-GLN-ALA-PHE-LEU-PHE-GLN-PRO-GLN-ARG-PHE-NH2 |