3,5-Dinitro-4-methylbenzoic Acid structure
|
Common Name | 3,5-Dinitro-4-methylbenzoic Acid | ||
|---|---|---|---|---|
| CAS Number | 16533-71-4 | Molecular Weight | 226.143 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 396.3±42.0 °C at 760 mmHg | |
| Molecular Formula | C8H6N2O6 | Melting Point | 155-158 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 176.1±16.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Methyl-3,5-dinitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 396.3±42.0 °C at 760 mmHg |
| Melting Point | 155-158 °C(lit.) |
| Molecular Formula | C8H6N2O6 |
| Molecular Weight | 226.143 |
| Flash Point | 176.1±16.3 °C |
| Exact Mass | 226.022583 |
| PSA | 128.94000 |
| LogP | 2.15 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | LZWWZQXBKVZKIP-UHFFFAOYSA-N |
| SMILES | Cc1c([N+](=O)[O-])cc(C(=O)O)cc1[N+](=O)[O-] |
| Storage condition | Flammables area |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2916399090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Pd-catalyzed carbonylative lactamization: a novel synthetic approach to FR900482.
Org. Lett. 6 , 1745, (2004) An asymmetric synthesis of the benzazocine core of FR900482 has been achieved in 15 steps from 3,5-dinitro-p-toluic acid. Key features of the synthesis include an enantioselective N-methylephedrine-me... |
|
|
Identification of highly polar nitroaromatic compounds in leachate and ground water samples from a TNT-contaminated waste site by LC-MS, LC-NMR, and off-line NMR and MS investigations.
Anal. Bioanal. Chem 389(6) , 1979-88, (2007) Leachate and ground water samples from a trinitrotoluene-contaminated waste disposal site near a former ammunitions plant in Stadtallendorf, Germany, were analyzed by liquid chromatography (LC)-mass s... |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 3,5-Dinitro-4-methyl benzoic acid |
| 4-Methyl-3,5-dinitrobenzoic acid |
| 3,5-Dinitro-4-toluic acid |
| 3,5-Dinitro-p-toluic Acid |
| 3,5-Dinitro-4-methylbenzoic Acid |
| EINECS 240-603-8 |
| MFCD00007175 |