Benzenamine,N-(4-methylphenyl)-2,4,6-trinitro- structure
|
Common Name | Benzenamine,N-(4-methylphenyl)-2,4,6-trinitro- | ||
|---|---|---|---|---|
| CAS Number | 16552-37-7 | Molecular Weight | 318.24200 | |
| Density | 1.535g/cm3 | Boiling Point | 440.8ºC at 760mmHg | |
| Molecular Formula | C13H10N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.4ºC | |
| Name | N-Picryl-p-toluidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.535g/cm3 |
|---|---|
| Boiling Point | 440.8ºC at 760mmHg |
| Molecular Formula | C13H10N4O6 |
| Molecular Weight | 318.24200 |
| Flash Point | 220.4ºC |
| Exact Mass | 318.06000 |
| PSA | 149.49000 |
| LogP | 5.10580 |
| Vapour Pressure | 5.75E-08mmHg at 25°C |
| Index of Refraction | 1.699 |
| InChIKey | RGVUBCNOPRVZKK-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Nc2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| HS Code | 2921440000 |
|---|
| HS Code | 2921440000 |
|---|---|
| Summary | 2921440000. diphenylamine and its derivatives; salts thereof. VAT:17.0%. Tax rebate rate:17.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(p-Tolyl)-2,4,6-trinitroaniline |
| 2,4,6-trinitro-4'-methyldiphenylamine |
| N-(4-Methylphenyl)-2,4,6-trinitroaniline |
| picryl-p-tolyl-amine |
| Picryl-p-tolyl-amin |
| Pikryl-p-toluidin |
| 1-(p-Methyl)phenylamino-2,4,6-trinitrobenzene |
| 2,4,6-Trinitro-N-(4-methylphenyl)aniline |
| N-(2,4,6-Trinitrophenyl)-4-methylaniline |
| 2'.4'.6'-Trinitro-4-methyl-diphenylamin |