Benzamide,2,4,6-trimethyl-N-(4-methylphenyl)- structure
|
Common Name | Benzamide,2,4,6-trimethyl-N-(4-methylphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 5215-42-9 | Molecular Weight | 253.33900 | |
| Density | 1.085g/cm3 | Boiling Point | 345.4ºC at 760 mmHg | |
| Molecular Formula | C17H19NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.6ºC | |
| Name | 2,4,6-trimethyl-N-(4-methylphenyl)benzamide |
|---|
| Density | 1.085g/cm3 |
|---|---|
| Boiling Point | 345.4ºC at 760 mmHg |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.33900 |
| Flash Point | 210.6ºC |
| Exact Mass | 253.14700 |
| PSA | 29.10000 |
| LogP | 4.24550 |
| Index of Refraction | 1.602 |
| InChIKey | JLJLFNVRWAISJZ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)c2c(C)cc(C)cc2C)cc1 |
|
~%
Benzamide,2,4,6... CAS#:5215-42-9 |
| Literature: Kadesch Journal of the American Chemical Society, 1942 , vol. 64, p. 726 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |