S 18886 structure
|
Common Name | S 18886 | ||
|---|---|---|---|---|
| CAS Number | 165538-40-9 | Molecular Weight | 407.91100 | |
| Density | 1.389g/cm3 | Boiling Point | 591.818ºC at 760 mmHg | |
| Molecular Formula | C20H22ClNO4S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 311.721ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of S 18886Terutroban is a thromboxane-prostaglandin receptor antagonist. |
| Name | 3-[(6R)-6-[(4-chlorophenyl)sulfonylamino]-2-methyl-5,6,7,8-tetrahydronaphthalen-1-yl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Terutroban is a thromboxane-prostaglandin receptor antagonist. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.389g/cm3 |
|---|---|
| Boiling Point | 591.818ºC at 760 mmHg |
| Molecular Formula | C20H22ClNO4S |
| Molecular Weight | 407.91100 |
| Flash Point | 311.721ºC |
| Exact Mass | 407.09600 |
| PSA | 91.85000 |
| LogP | 4.97310 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.637 |
| InChIKey | HWEOXFSBSQIWSY-MRXNPFEDSA-N |
| SMILES | Cc1ccc2c(c1CCC(=O)O)CCC(NS(=O)(=O)c1ccc(Cl)cc1)C2 |
| Storage condition | 2-8℃ |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| Terutroban [INN] |
| UNII-A6WX9391D8 |
| terutroban |
| 3-{6-[(4-chlorophenylsulphonyl)amino]-2-methyl-5,6,7,8-tetrahydronaphth-1-yl}-propionic acid |