1-Acetyladamantane structure
|
Common Name | 1-Acetyladamantane | ||
|---|---|---|---|---|
| CAS Number | 1660-04-4 | Molecular Weight | 178.271 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 262.3±8.0 °C at 760 mmHg | |
| Molecular Formula | C12H18O | Melting Point | 53-55 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 107.4±6.1 °C | |
| Name | 1-Adamantyl methyl ketone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 262.3±8.0 °C at 760 mmHg |
| Melting Point | 53-55 °C(lit.) |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.271 |
| Flash Point | 107.4±6.1 °C |
| Exact Mass | 178.135757 |
| PSA | 17.07000 |
| LogP | 2.73 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.533 |
| InChIKey | DACIGVIOAFXPHW-UHFFFAOYSA-N |
| SMILES | CC(=O)C12CC3CC(CC(C3)C1)C2 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2914299000 |
| Precursor 9 | |
|---|---|
| DownStream 9 | |
| HS Code | 2914299000 |
|---|---|
| Summary | 2914299000. other cyclanic, cyclenic or cyclotherpenic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
|
Stereoselective ketone reduction by a carbonyl reductase from Sporobolomyces salmonicolor. Substrate specificity, enantioselectivity and enzyme-substrate docking studies.
Org. Biomol. Chem. 4(14) , 2690-5, (2006) In our effort to search for effective carbonyl reductases, the activity and enantioselectivity of a carbonyl reductase from Sporobolomyces salmonicolor have been evaluated toward the reduction of a va... |
| 1-Acetyladamantane |
| Methyl 1-mdamantyl ketone |
| 1-Adamantan-1-ylethanone |
| MFCD00074739 |
| Ethanone, 1-tricyclo[3.3.1.1]dec-1-yl- |
| 1-Acetyl Adamantane |
| 1-Adamantyl methyl ketone |
| Methyl 1-Adamantyl Ketone |
| 1-(1-adamantyl)ethan-1-one |
| EINECS 216-761-9 |
| 1-(Adamantan-1-yl)ethanone |