EGFR-IN-3 structure
|
Common Name | EGFR-IN-3 | ||
|---|---|---|---|---|
| CAS Number | 1660963-42-7 | Molecular Weight | 530.568 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C29H28F2N6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of EGFR-IN-3EGFR-IN-3 is an epidermal growth factor receptor (EGFR) inhibitor. |
| Name | RX518 |
|---|---|
| Synonym | More Synonyms |
| Description | EGFR-IN-3 is an epidermal growth factor receptor (EGFR) inhibitor. |
|---|---|
| Related Catalog | |
| Target |
EGFR. |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C29H28F2N6O2 |
| Molecular Weight | 530.568 |
| Exact Mass | 530.224182 |
| LogP | 4.14 |
| Index of Refraction | 1.674 |
| InChIKey | IDRGFNPZDVBSSE-UHFFFAOYSA-N |
| SMILES | C=CC(=O)Nc1cccc(-c2cccc3cnc(Nc4ccc(N5CCN(CCO)CC5)c(F)c4F)nc23)c1 |
| Storage condition | 2-8℃ |
| 2-Propenamide, N-[3-[2-[[2,3-difluoro-4-[4-(2-hydroxyethyl)-1-piperazinyl]phenyl]amino]-8-quinazolinyl]phenyl]- |
| N-{3-[2-({2,3-Difluoro-4-[4-(2-hydroxyethyl)-1-piperazinyl]phenyl}amino)-8-quinazolinyl]phenyl}acrylamide |