2,4,6-tris(chlorodifluoromethyl)-1,3,5-triazine structure
|
Common Name | 2,4,6-tris(chlorodifluoromethyl)-1,3,5-triazine | ||
|---|---|---|---|---|
| CAS Number | 16617-00-8 | Molecular Weight | 334.43400 | |
| Density | 1.433g/cm3 | Boiling Point | 84°C 35mm | |
| Molecular Formula | C6Cl3F6N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 19.8ºC | |
| Name | 2,4,6-tris[chloro(difluoro)methyl]-1,3,5-triazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.433g/cm3 |
|---|---|
| Boiling Point | 84°C 35mm |
| Molecular Formula | C6Cl3F6N3 |
| Molecular Weight | 334.43400 |
| Flash Point | 19.8ºC |
| Exact Mass | 332.90600 |
| PSA | 38.67000 |
| LogP | 3.73590 |
| Vapour Pressure | 0.0888mmHg at 25°C |
| Index of Refraction | 1.414 |
| InChIKey | MYPGWKSSWURUMJ-UHFFFAOYSA-N |
| SMILES | FC(F)(Cl)c1nc(C(F)(F)Cl)nc(C(F)(F)Cl)n1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/38 |
| Safety Phrases | S26-S36 |
| HS Code | 2933699090 |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 2,4,6-tris-(chloro-difluoro-methyl)-[1,3,5]triazine |
| MFCD00041470 |
| Tris(chlorodifluoromethyl)-1,3,5-triazine |
| Tris-(difluor-chlor-methyl)-sym-triazin |
| 2,3-DIMETHYL-2'-MORPHOLINOMETHYL BENZOPHENONE |