Benzenesulfonic acid,4-methyl-, 2-(phenylmethylene)hydrazide structure
|
Common Name | Benzenesulfonic acid,4-methyl-, 2-(phenylmethylene)hydrazide | ||
|---|---|---|---|---|
| CAS Number | 1666-17-7 | Molecular Weight | 274.338 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 431.8±38.0 °C at 760 mmHg | |
| Molecular Formula | C14H14N2O2S | Melting Point | 130ºC | |
| MSDS | Chinese USA | Flash Point | 214.9±26.8 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | benzaldehyde tosylhydrazone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 431.8±38.0 °C at 760 mmHg |
| Melting Point | 130ºC |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.338 |
| Flash Point | 214.9±26.8 °C |
| Exact Mass | 274.077606 |
| PSA | 66.91000 |
| LogP | 3.35 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | FZFLTDNAHASQQC-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NN=Cc2ccccc2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-37/39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2935009090 |
|
~96%
Benzenesulfonic... CAS#:1666-17-7 |
| Literature: Toth, Marietta; Somsak, Laszlo Tetrahedron Letters, 2001 , vol. 42, # 14 p. 2723 - 2725 |
|
~88%
Benzenesulfonic... CAS#:1666-17-7 |
| Literature: Admasu, Atnaf; Platz, Matthew S.; Marcinek, Andrzej; Michalak, Jacek; Gudmundsdottir, Anna Dora; Gebicki, Jerzy Journal of Physical Organic Chemistry, 1997 , vol. 10, # 4 p. 207 - 220 |
|
~%
Benzenesulfonic... CAS#:1666-17-7 |
| Literature: US4629784 A1, ; |
|
~%
Benzenesulfonic... CAS#:1666-17-7 |
| Literature: Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, , vol. 40, # 7 p. 579 - 583 |
|
~%
Benzenesulfonic... CAS#:1666-17-7 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 440, p. 51 |
| Precursor 5 | |
|---|---|
| DownStream 9 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 4-Methyl-N'-[(E)-phenylmethylene]benzenesulfonohydrazide |
| Benzenesulfonic acid, 4-methyl-, 2-[(1E)-phenylmethylene]hydrazide |
| benzaldehyde (p-tosyl)hydrazone |
| N'-Benzylidene-p-toluenesulfonic acid hydrazide |
| N2-Benzylidene-4-methylbenzenesulfonohydrazide |
| p-Toluenesulfonic acid N'-benzylidene hydrazide |
| benzaldehyde toluene-p-sulphonylhydrazone |
| N'-Benzylidene-4-methylbenzenesulfonohydrazide |
| Benzaldehyde p-Toluenesulfonylhydrazone |
| N-(benzylideneamino)-4-methyl-benzenesulfonamide |
| 4-methyl-N'-benzylidenebenzene-1-sulfonohydrazide |
| 4-methylbenzenesulfonic acid N-methylidene-hydrazide |
| N-benzylideneamino-p-toluenesulfonamide |
| 4-methyl-N-(phenylmethylideneamino)benzenesulfonamide |
| Benzaldehyde Tosylhydrazone |
| Benzaldehyde [(4-methylphenyl)sulfonyl]hydrazone |
| MFCD00009644 |