methoxycarbonylglycine 4-nitrophenyl ester structure
|
Common Name | methoxycarbonylglycine 4-nitrophenyl ester | ||
|---|---|---|---|---|
| CAS Number | 1670-94-6 | Molecular Weight | 254.19600 | |
| Density | 1.379g/cm3 | Boiling Point | 446.6ºC at 760mmHg | |
| Molecular Formula | C10H10N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.9ºC | |
| Name | (4-nitrophenyl) 2-(methoxycarbonylamino)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.379g/cm3 |
|---|---|
| Boiling Point | 446.6ºC at 760mmHg |
| Molecular Formula | C10H10N2O6 |
| Molecular Weight | 254.19600 |
| Flash Point | 223.9ºC |
| Exact Mass | 254.05400 |
| PSA | 113.94000 |
| LogP | 1.58380 |
| Vapour Pressure | 3.59E-08mmHg at 25°C |
| Index of Refraction | 1.551 |
| InChIKey | BNYHIOHEEQKXIR-UHFFFAOYSA-N |
| SMILES | COC(=O)NCC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2924299090 |
|---|
|
~89%
methoxycarbonyl... CAS#:1670-94-6 |
| Literature: Nakagawa, Masako; Sodeoka, Mikiko; Yamaguchi, Keiichi; Hino, Tohru Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 4 p. 1373 - 1384 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| p-Nitrophenylcarbomethoxyglycinate |
| 4-nitrophenyl n-(methoxycarbonyl)glycinate |
| Methoxycarbonylglycine 4-nitrophenyl ester |
| p-Nitrophenylcarbomethoxyglycinate (NPCMG) |
| MC-Gly-NP |
| N-methoxycarbonylglycine p-nitrophenyl ester |
| Glycine,N-(methoxycarbonyl)-,4-nitrophenyl ester |
| N-Methoxycarbonylglycin-p-nitrophenylester |