Benzoic acid,4-nitrophenyl ester structure
|
Common Name | Benzoic acid,4-nitrophenyl ester | ||
|---|---|---|---|---|
| CAS Number | 959-22-8 | Molecular Weight | 243.21500 | |
| Density | 1.316g/cm3 | Boiling Point | 399.5ºC at 760mmHg | |
| Molecular Formula | C13H9NO4 | Melting Point | 142-144ºC | |
| MSDS | N/A | Flash Point | 183.5ºC | |
| Name | (4-nitrophenyl) benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.316g/cm3 |
|---|---|
| Boiling Point | 399.5ºC at 760mmHg |
| Melting Point | 142-144ºC |
| Molecular Formula | C13H9NO4 |
| Molecular Weight | 243.21500 |
| Flash Point | 183.5ºC |
| Exact Mass | 243.05300 |
| PSA | 72.12000 |
| LogP | 3.33720 |
| Index of Refraction | 1.614 |
| InChIKey | GMKZBFFLCONHDE-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| Safety Phrases | S22-S24/25 |
|---|---|
| HS Code | 2916310090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916310090 |
|---|---|
| Summary | 2916310090 other benzoic acid and its salts and esters。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Phenol,p-nitro-,benzoate |
| 4-benzyloxynitrobenzene |
| MFCD00135494 |
| Benzoic acid,p-nitrophenyl ester |
| 4-Nitrophenyl benzoate |
| p-nitrophenyl benzoate |
| Benzoic acid,4-nitrophenyl ester |