(R)-Ethyl piperidine-3-carboxylate (2R,3R)-2,3-dihydroxysuccinate structure
|
Common Name | (R)-Ethyl piperidine-3-carboxylate (2R,3R)-2,3-dihydroxysuccinate | ||
|---|---|---|---|---|
| CAS Number | 167392-57-6 | Molecular Weight | 307.297 | |
| Density | N/A | Boiling Point | 504.6ºC at 760mmHg | |
| Molecular Formula | C12H21NO8 | Melting Point | 157-159 °C(lit.) | |
| MSDS | USA | Flash Point | 259ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (R)-3-Piperidinecarboxylic Acid Ethyl Ester L-Tartrate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 504.6ºC at 760mmHg |
|---|---|
| Melting Point | 157-159 °C(lit.) |
| Molecular Formula | C12H21NO8 |
| Molecular Weight | 307.297 |
| Flash Point | 259ºC |
| Exact Mass | 307.126709 |
| PSA | 153.39000 |
| Vapour Pressure | 0.042mmHg at 25°C |
| Index of Refraction | 10.3 ° (C=5, H2O) |
| InChIKey | HHPGQKZOPPDLNH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCCNC1.O=C(O)C(O)C(O)C(=O)O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36 |
| Safety Phrases | S26-S36-S39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ethyl (R)-Nipecotate L-Tartarate |
| MFCD00799538 |
| Ethyl (R)-nipecotate |
| 3-Piperidinecarboxylic acid, ethyl ester, (3R)-, compd. with (2S,3S)-2,3-dihydroxybutanedioic acid (1:1) |
| ETHYL (R)-NIPECOTATE L-TARTRATE |
| Ethyl (R)-3-Piperidinecarboxylate L-Tartrate |
| (2S,3S)-2,3-Dihydroxysuccinic acid - ethyl (3R)-3-piperidinecarboxylate (1:1) |
| (R)-Ethyl piperidine-3-carboxylate (2R,3R)-2,3-dihydroxysuccinate |
| (R)-Nipecotic Acid Ethyl Ester L-Tartrate |
| Ethyl (R)-nipecotate-L-tartrate |
| Ethyl®-nipecotate,L-tartrate |