N-[4-chloro-2-nitro-5-(trifluoromethyl)phenyl]-2,2,2-trifluoroacetamide
Modify Date: 2025-09-04 23:01:54
![N-[4-chloro-2-nitro-5-(trifluoromethyl)phenyl]-2,2,2-trifluoroacetamide Structure](https://image.chemsrc.com/caspic/439/167415-21-6.png)
N-[4-chloro-2-nitro-5-(trifluoromethyl)phenyl]-2,2,2-trifluoroacetamide structure
|
Common Name | N-[4-chloro-2-nitro-5-(trifluoromethyl)phenyl]-2,2,2-trifluoroacetamide | ||
|---|---|---|---|---|
| CAS Number | 167415-21-6 | Molecular Weight | 336.57500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H3ClF6N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[4-chloro-2-nitro-5-(trifluoromethyl)phenyl]-2,2,2-trifluoroacetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H3ClF6N2O3 |
|---|---|
| Molecular Weight | 336.57500 |
| Exact Mass | 335.97400 |
| PSA | 78.41000 |
| LogP | 4.94050 |
| InChIKey | HJUKMKSJPNUVPB-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cc(C(F)(F)F)c(Cl)cc1[N+](=O)[O-])C(F)(F)F |
| HS Code | 2924299090 |
|---|
|
~84%
N-[4-chloro-2-n... CAS#:167415-21-6 |
| Literature: Journal of Organic Chemistry, , vol. 60, # 18 p. 5838 - 5842 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:167415-22-7| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EA-0728 |
| chloronitrotrifluoromethylphenyltrifluoroacetamide |
| 2-Chloro-5-(trifluoroacetamido)-4-nitrobenzotrifluoride |
| 4-Chloro-2-nitro-N-(trifluoroacetyl)-5-(trifluoromethyl)aniline |