5-Amino-2-chloro-4-nitrobenzotrifluoride structure
|
Common Name | 5-Amino-2-chloro-4-nitrobenzotrifluoride | ||
|---|---|---|---|---|
| CAS Number | 167415-22-7 | Molecular Weight | 240.567 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 322.6±42.0 °C at 760 mmHg | |
| Molecular Formula | C7H4ClF3N2O2 | Melting Point | 123-125ºC | |
| MSDS | N/A | Flash Point | 148.9±27.9 °C | |
| Name | 4-Chloro-2-nitro-5-(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 322.6±42.0 °C at 760 mmHg |
| Melting Point | 123-125ºC |
| Molecular Formula | C7H4ClF3N2O2 |
| Molecular Weight | 240.567 |
| Flash Point | 148.9±27.9 °C |
| Exact Mass | 239.991333 |
| PSA | 71.84000 |
| LogP | 4.37 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | HLEWKRQSGSZHGO-UHFFFAOYSA-N |
| SMILES | Nc1cc(C(F)(F)F)c(Cl)cc1[N+](=O)[O-] |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2921420090 |
|
~91%
5-Amino-2-chlor... CAS#:167415-22-7 |
| Literature: Kher, Sunil M.; Cai, Sui Xiong; Weber, Eckard; Keana, John F. W. Journal of Organic Chemistry, 1995 , vol. 60, # 18 p. 5838 - 5842 |
|
~%
5-Amino-2-chlor... CAS#:167415-22-7 |
| Literature: Journal of Organic Chemistry, , vol. 60, # 18 p. 5838 - 5842 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-Chloro-2-nitro-5-(trifluoromethyl)aniline |
| chloronitrotrifluoromethylaniline |
| 5-Amino-2-chloro-4-nitrobenzotrifluoride |
| 2-Nitro-4-chloro-5-(trifluoromethyl)aniline |
| 3-amino-6-chloro-4-nitrobenzotrifluoride |
| Benzenamine, 4-chloro-2-nitro-5-(trifluoromethyl)- |