erythromycin C structure
|
Common Name | erythromycin C | ||
|---|---|---|---|---|
| CAS Number | 1675-02-1 | Molecular Weight | 719.90 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 826.2±65.0 °C at 760 mmHg | |
| Molecular Formula | C36H65NO13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 453.5±34.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of erythromycin CErythromycin C is an antibiotic. Erythromycin C could be isolated from the fermentation process of the penicillium Streptomyces erythreus[1]. |
| Name | erythromycin C |
|---|---|
| Synonym | More Synonyms |
| Description | Erythromycin C is an antibiotic. Erythromycin C could be isolated from the fermentation process of the penicillium Streptomyces erythreus[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 826.2±65.0 °C at 760 mmHg |
| Molecular Formula | C36H65NO13 |
| Molecular Weight | 719.90 |
| Flash Point | 453.5±34.3 °C |
| Exact Mass | 719.445618 |
| PSA | 204.91000 |
| LogP | 2.41 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | MWFRKHPRXPSWNT-QNPWSHAKSA-N |
| SMILES | CCC1OC(=O)C(C)C(OC2CC(C)(O)C(O)C(C)O2)C(C)C(OC2OC(C)CC(N(C)C)C2O)C(C)(O)CC(C)C(=O)C(C)C(O)C1(C)O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
|
Tadeusz Korzybski, Zuzanna Kowszyk-Gindifer, Wlodzimierz Kurylowicz;
Antibiotics: origin, nature, and properties 1st ed.,, 182, (2013)
|
| (3R,4S,5S,6R,7R,9R,11R,12R,13S,14R)-4-{[(2R,4R,5S,6S)-4,5-dihydroxy-4,6-dimethyltetrahydro-2H-pyran-2-yl]oxy}-6-{[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyltetrahydro-2H-pyran-2-yl]oxy}-14-ethyl-7,12,13-trihydroxy-3,5,7,9,11,13-hexamethyloxacyclotetradecane-2,10-dione (non-preferred name) |
| erythromycin C |
| (3R,4S,5S,6R,7R,9R,11R,12R,13S,14R)-4-{[(2R,4R,5S,6S)-4,5-Dihydroxy-4,6-dimethyltetrahydro-2H-pyran-2-yl]oxy}-6-{[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyltetrahydro-2H-pyran-2-yl]oxy}-14-ethyl-7,12,13-trihydroxy-3,5,7,9,11,13-hexamethyloxacyclotetradecane-2,10-dione |
| 3-o-demethylerythromycin |