H-Glu(OBzl)-OH structure
|
Common Name | H-Glu(OBzl)-OH | ||
|---|---|---|---|---|
| CAS Number | 1676-73-9 | Molecular Weight | 237.252 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 426.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C12H15NO4 | Melting Point | 181-182 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 211.5±28.7 °C | |
Use of H-Glu(OBzl)-OHL-Glutamate-γ-benzyl ester is a glutamic acid derivative[1]. |
| Name | L-Glutamic acid γ-benzyl ester |
|---|---|
| Synonym | More Synonyms |
| Description | L-Glutamate-γ-benzyl ester is a glutamic acid derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 426.1±45.0 °C at 760 mmHg |
| Melting Point | 181-182 °C(lit.) |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.252 |
| Flash Point | 211.5±28.7 °C |
| Exact Mass | 237.100113 |
| PSA | 89.62000 |
| LogP | 1.56 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.555 |
| InChIKey | BGGHCRNCRWQABU-JTQLQIEISA-M |
| SMILES | NC(CCC(=O)OCc1ccccc1)C(=O)[O-] |
| Storage condition | 2~8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2922509090 |
| Precursor 7 | |
|---|---|
| DownStream 10 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| H-Glu(OBzl)-OH;; L-Glutamic acid γ-benzyl ester |
| EINECS 216-826-1 |
| L-Glutamic acid γ-benzyl ester |
| L-Glutamic acid 5-benzyl ester |
| γ-Benzyl L-glutamate |
| L-Glutamic acid, 5-(phenylmethyl) ester |
| H-Glu(OBzl)-OH |
| 5-Benzyl L-GlutaMate |
| L-Glutamic acid alpha-benzyl ester |
| (2S)-2-Amino-5-(benzyloxy)-5-oxopentanoic acid |
| L-Glutamic acid, 5- (phenylmethyl) ester |
| gamma-Benzyl L-glutamate |
| L-Glutamic acid 1-Benzyl Ester |
| (S)-4-Amino-5-(benzyloxy)-5-oxopentanoic acid |
| 1-Benzyl L-glutamate |
| MFCD00002633 |
| L-Glutamic acid α-benzyl ester |
| L-Glutamic acid α-benzylester |