rubelloside B structure
|
Common Name | rubelloside B | ||
|---|---|---|---|---|
| CAS Number | 167875-39-0 | Molecular Weight | 794.97 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 912.8±65.0 °C at 760 mmHg | |
| Molecular Formula | C42H66O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269.1±27.8 °C | |
Use of rubelloside BRubelloside B, a triterpenoid glycoside, can be isolated from the roots of Adina rubella. Rubelloside B shows Immunological Enhancement[1]. |
| Name | (3β)-3-{[6-Deoxy-4-O-(β-D-glucopyranosyl)-β-D-galactopyranosyl]ox y}urs-12-ene-27,28-dioic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Rubelloside B, a triterpenoid glycoside, can be isolated from the roots of Adina rubella. Rubelloside B shows Immunological Enhancement[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Fang SY, et al. Triterpenoid glycosides from Adina rubella. Phytochemistry. 1995 Jul;39(5):1241-3. |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 912.8±65.0 °C at 760 mmHg |
| Molecular Formula | C42H66O14 |
| Molecular Weight | 794.97 |
| Flash Point | 269.1±27.8 °C |
| Exact Mass | 794.445251 |
| PSA | 232.90000 |
| LogP | 5.41 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.610 |
| InChIKey | IIIOQVDDEWZCEQ-UHFFFAOYSA-N |
| SMILES | CC1CCC2(C(=O)O)CCC3(C(=O)O)C(=CCC4C5(C)CCC(OC6OC(C)C(OC7OC(CO)C(O)C(O)C7O)C(O)C6O)C(C)(C)C5CCC43C)C2C1C |
| Hazard Codes | Xi |
|---|
| Urs-12-ene-27,28-dioic acid, 3-[(6-deoxy-4-O-β-D-glucopyranosyl-β-D-galactopyranosyl)oxy]-, (3β)- |
| (3β)-3-{[6-Deoxy-4-O-(β-D-glucopyranosyl)-β-D-galactopyranosyl]oxy}urs-12-ene-27,28-dioic acid |