1-(2-Bromoethyl)-3-nitrobenzene structure
|
Common Name | 1-(2-Bromoethyl)-3-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 16799-04-5 | Molecular Weight | 230.05900 | |
| Density | N/A | Boiling Point | 136-138ºC/0.5 mmHg | |
| Molecular Formula | C8H8BrNO2 | Melting Point | 30-34ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-(2-Bromoethyl)-3-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 136-138ºC/0.5 mmHg |
|---|---|
| Melting Point | 30-34ºC |
| Molecular Formula | C8H8BrNO2 |
| Molecular Weight | 230.05900 |
| Exact Mass | 228.97400 |
| PSA | 45.82000 |
| LogP | 3.05540 |
| InChIKey | JZBRVWQGWOLPAT-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(CCBr)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H317-H319 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2904909090 |
|
~%
1-(2-Bromoethyl... CAS#:16799-04-5 |
| Literature: Chugai Seiyaku Kabushiki Kaisha Patent: US6534546 B1, 2003 ; |
|
~%
1-(2-Bromoethyl... CAS#:16799-04-5 |
| Literature: Weibel,P.A.; Hesse,M. Helvetica Chimica Acta, 1973 , vol. 56, p. 2460 - 2479 |
|
~%
1-(2-Bromoethyl... CAS#:16799-04-5 |
| Literature: Weibel,P.A.; Hesse,M. Helvetica Chimica Acta, 1973 , vol. 56, p. 2460 - 2479 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| m-nitrophenethyl bromide |
| 1-(bromoethyl)-3-nitrobenzene |
| 3-Nitrophenethyl bromide |
| 3-nitrophenylethyl bromide |
| 3-(2-Bromoethyl)nitrobenzene |
| Benzene,1-(2-bromoethyl)-3-nitro |
| 1-(2-bromo-ethyl)-3-nitro-benzene |