3-Nitrophenylaceticacid structure
|
Common Name | 3-Nitrophenylaceticacid | ||
|---|---|---|---|---|
| CAS Number | 1877-73-2 | Molecular Weight | 181.145 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 373.8±17.0 °C at 760 mmHg | |
| Molecular Formula | C8H7NO4 | Melting Point | 117-120 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 169.8±9.4 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-(3-nitrophenyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 373.8±17.0 °C at 760 mmHg |
| Melting Point | 117-120 °C(lit.) |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | 181.145 |
| Flash Point | 169.8±9.4 °C |
| Exact Mass | 181.037506 |
| PSA | 83.12000 |
| LogP | 1.24 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | WUKHOVCMWXMOOA-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1cccc([N+](=O)[O-])c1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATAMUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | AJ1129900 |
| HS Code | 2916399090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Synthesis and application of an azobenzene amino acid as a light-switchable turn element in polypeptides.
Nat. Protoc. 2(1) , 161-7, (2007) The synthesis of an azobenzene amino acid (aa) for use as a photo-inducible conformational switch in polypeptides is described. The compound can be easily incorporated into an aa sequence by solid-pha... |
|
|
A mild oxidation of aromatic amines. Webb KS and Seneviratne S.
Tetrahedron Lett. 36(14) , 2377-2378, (1995)
|
|
|
Photodecarboxylation of nitrophenylacetate ions. Margerum JD and Petrusis CT.
J. Am. Chem. Soc. 91(10) , 2467-2472, (1969)
|
| 3-nitrophenylethanoic acid |
| 3-Nitrobenzeneacetic acid |
| EINECS 217-512-7 |
| Benzeneacetic acid, 3-nitro- |
| m-nitrophenyl-acetic acid |
| 3-Nitrophenylacetic acid |
| Benzeneacetic acid,3-nitro |
| MFCD00007278 |
| (3-Nitrophenyl)acetic acid |
| 3-Nitrophenylaceticacid |