tert-Butyl (1-(hydroxymethyl)cyclopentyl)carbamate structure
|
Common Name | tert-Butyl (1-(hydroxymethyl)cyclopentyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 168540-07-6 | Molecular Weight | 215.289 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 329.5±11.0 °C at 760 mmHg | |
| Molecular Formula | C11H21NO3 | Melting Point | 108-112ºC | |
| MSDS | N/A | Flash Point | 153.1±19.3 °C | |
| Name | n-boc-1-amino-1-cyclopentanemethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 329.5±11.0 °C at 760 mmHg |
| Melting Point | 108-112ºC |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.289 |
| Flash Point | 153.1±19.3 °C |
| Exact Mass | 215.152145 |
| PSA | 58.56000 |
| LogP | 1.62 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.488 |
| InChIKey | KORMKULLVQEUDG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CO)CCCC1 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Methyl-2-propanyl [1-(hydroxymethyl)cyclopentyl]carbamate |
| 1-BOC-AMINO-1-HYDROXYMETHYLCYCLOPENTANE |
| 1-Boc-amino-cyclopentylmethanol |
| Carbamic acid, N-[1-(hydroxymethyl)cyclopentyl]-, 1,1-dimethylethyl ester |
| tert-Butyl (1-(hydroxyMethyl)cyclopentyl)carbaMate |