tert-Butyl [1-(hydroxymethyl)cyclobutyl]carbamate structure
|
Common Name | tert-Butyl [1-(hydroxymethyl)cyclobutyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 1142211-17-3 | Molecular Weight | 201.263 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 312.2±11.0 °C at 760 mmHg | |
| Molecular Formula | C10H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.6±19.3 °C | |
| Name | tert-Butyl (1-(hydroxymethyl)cyclobutyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 312.2±11.0 °C at 760 mmHg |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.263 |
| Flash Point | 142.6±19.3 °C |
| Exact Mass | 201.136490 |
| PSA | 62.05000 |
| LogP | 1.06 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.489 |
| InChIKey | CLRGYDRXIYIAHC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CO)CCC1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
|
~%
tert-Butyl [1-(... CAS#:1142211-17-3 |
| Literature: ACHAOGEN, INC.; BRUSS, Jon, B.; MILLER, George, H.; AGGEN, James, Bradley; ARMSTRONG, Eliana, Saxon Patent: WO2010/132777 A2, 2010 ; Location in patent: Page/Page column 195; 48-49 ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Methyl-2-propanyl [1-(hydroxymethyl)cyclobutyl]carbamate |
| Carbamic acid, N-[1-(hydroxymethyl)cyclobutyl]-, 1,1-dimethylethyl ester |
| tert-Butyl [1-(hydroxymethyl)cyclobutyl]carbamate |
| tert-butyl N-[1-(hydroxymethyl)cyclobutyl]carbamate |
| N-Boc-1-amino-cyclobutyl-methanol |