H-Glu(Abu-OH)-OH structure
|
Common Name | H-Glu(Abu-OH)-OH | ||
|---|---|---|---|---|
| CAS Number | 16869-42-4 | Molecular Weight | 232.23 | |
| Density | 1.314g/cm3 | Boiling Point | 555.5ºC at 760mmHg | |
| Molecular Formula | C9H16N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 289.8ºC | |
Use of H-Glu(Abu-OH)-OHGamma-Glu-Abu is a potent calcium sensing receptor (CaSR) agonist[1]. |
| Name | H-γ-GLU-ABU-OH |
|---|---|
| Synonym | More Synonyms |
| Description | Gamma-Glu-Abu is a potent calcium sensing receptor (CaSR) agonist[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.314g/cm3 |
|---|---|
| Boiling Point | 555.5ºC at 760mmHg |
| Molecular Formula | C9H16N2O5 |
| Molecular Weight | 232.23 |
| Flash Point | 289.8ºC |
| Exact Mass | 232.10600 |
| PSA | 129.72000 |
| LogP | 0.24910 |
| Vapour Pressure | 8.43E-14mmHg at 25°C |
| Index of Refraction | 1.522 |
| InChIKey | FUZOZPRKGAXGOB-UHFFFAOYSA-N |
| SMILES | CCC(NC(=O)CCC(N)C(=O)O)C(=O)O |
| HS Code | 2924199090 |
|---|
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| H-GLU(ABU-OH)-OH |
| H-g-Glu-Abu-OH |