H-Glu(Gly-OH)-OH structure
|
Common Name | H-Glu(Gly-OH)-OH | ||
|---|---|---|---|---|
| CAS Number | 1948-29-4 | Molecular Weight | 204.18100 | |
| Density | 1.424g/cm3 | Boiling Point | 586.6ºC at 760mmHg | |
| Molecular Formula | C7H12N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 308.6ºC | |
Use of H-Glu(Gly-OH)-OHγ-Glu-Gly, a γ-glutamyl dipeptide, is a human lipid metabolite.γ-Glu-Gly has a similar structure to GABA (γ-aminobutyric acid) and can act as an antagonist of excitatory amino acids[1][2][3]. |
| Name | 2-amino-5-(carboxymethylamino)-5-oxopentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | γ-Glu-Gly, a γ-glutamyl dipeptide, is a human lipid metabolite.γ-Glu-Gly has a similar structure to GABA (γ-aminobutyric acid) and can act as an antagonist of excitatory amino acids[1][2][3]. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| In Vitro | γ-Glu-Gly is a key component that influence the flavor of mature cheese. In S. cerevisiae, γ-Glutamyltransferase (GGT) produces two γ-glutamyl peptides, γ-Glu-Glu and γ-Glu-Gly[1]. |
| References |
| Density | 1.424g/cm3 |
|---|---|
| Boiling Point | 586.6ºC at 760mmHg |
| Molecular Formula | C7H12N2O5 |
| Molecular Weight | 204.18100 |
| Flash Point | 308.6ºC |
| Exact Mass | 204.07500 |
| PSA | 129.72000 |
| Vapour Pressure | 2.78E-15mmHg at 25°C |
| Index of Refraction | 1.536 |
| InChIKey | ACIJGUBIMXQCMF-BYPYZUCNSA-N |
| SMILES | NC(CCC(=O)NCC(=O)O)C(=O)O |
| HS Code | 2924199090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| H-g-Glu-Gly-OH |
| H-GLU(GLY)-OH |
| L-Y-GLUTAMYL-GLYCINE |
| H-GLU(GLY-OH)-OH |
| H-Glu-Gly-OH |
| H-γ-Glu-Gly-OH |