N-Benzyloxycarbonyl-L-proline tert-butyl ester structure
|
Common Name | N-Benzyloxycarbonyl-L-proline tert-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 16881-39-3 | Molecular Weight | 305.369 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 404.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C17H23NO4 | Melting Point | 45ºC | |
| MSDS | N/A | Flash Point | 198.6±28.7 °C | |
Use of N-Benzyloxycarbonyl-L-proline tert-butyl esterN-Carbobenzoxy-L-proline tert-Butyl Ester is a proline derivative[1]. |
| Name | N-Cbz-L-proline tert-Butyl Ester |
|---|---|
| Synonym | More Synonyms |
| Description | N-Carbobenzoxy-L-proline tert-Butyl Ester is a proline derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 404.8±45.0 °C at 760 mmHg |
| Melting Point | 45ºC |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.369 |
| Flash Point | 198.6±28.7 °C |
| Exact Mass | 305.162720 |
| PSA | 55.84000 |
| LogP | 2.87 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.533 |
| InChIKey | OULMZZGGALAOLR-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC(=O)C1CCCN1C(=O)OCc1ccccc1 |
| Storage condition | -15°C |
| Safety Phrases | S22-S24/25 |
|---|---|
| HS Code | 2933990090 |
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-Benzyloxycarbonyl-L-proline tert-butyl ester |
| 1-Benzyl 2-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate |
| N-Carbobenzoxy-L-proline tert-Butyl Ester |
| 1,2-Pyrrolidinedicarboxylic acid, 2-(1,1-dimethylethyl) 1-(phenylmethyl) ester, (2S)- |
| EINECS 240-911-2 |
| 1-Benzyl 2-(2-methyl-2-propanyl) (2S)-1,2-pyrrolidinedicarboxylate |
| N-CBZ-L-PROLINE TERT-BUTYL ESTER |
| MFCD00051777 |