Heterocyclyl carbamate derivative 1 structure
|
Common Name | Heterocyclyl carbamate derivative 1 | ||
|---|---|---|---|---|
| CAS Number | 168830-01-1 | Molecular Weight | 415.53 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H29N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Heterocyclyl carbamate derivative 1Heterocyclyl carbamate derivative 1 is a heterocyclyl carbamate derivative that may be used for the research of inflammatory and neurological diseases. |
| Name | Heterocyclyl carbamate derivative 1 |
|---|
| Description | Heterocyclyl carbamate derivative 1 is a heterocyclyl carbamate derivative that may be used for the research of inflammatory and neurological diseases. |
|---|---|
| Related Catalog | |
| In Vitro | Heterocyclyl carbamate derivative 1 is a heterocyclyl carbamate derivative that may be used for the research of inflammatory and neurological diseases[1]. |
| References |
| Molecular Formula | C26H29N3O2 |
|---|---|
| Molecular Weight | 415.53 |
| InChIKey | BUXIWTJVINPFPP-UHFFFAOYSA-N |
| SMILES | Nc1cccc(CN2CCC(OC(=O)NC(c3ccccc3)c3ccccc3)CC2)c1 |