Tetraethylammonium benzoate structure
|
Common Name | Tetraethylammonium benzoate | ||
|---|---|---|---|---|
| CAS Number | 16909-22-1 | Molecular Weight | 251.36400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H25NO2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | tetraethylazanium,benzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H25NO2 |
|---|---|
| Molecular Weight | 251.36400 |
| Exact Mass | 251.18900 |
| PSA | 40.13000 |
| LogP | 1.93290 |
| InChIKey | CIFIGXMZHITUAZ-UHFFFAOYSA-M |
| SMILES | CC[N+](CC)(CC)CC.O=C([O-])c1ccccc1 |
| Water Solubility | H2O: 0.1 g/mL, clear, colorless |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2923900090 |
|
~%
Tetraethylammon... CAS#:16909-22-1 |
| Literature: Awata, Takeshi; Baizer, Manuel M.; Nonaka, Tsutomu; Fuchigami, Toshio Chemistry Letters, 1985 , p. 371 - 374 |
|
~%
Tetraethylammon... CAS#:16909-22-1 |
| Literature: Nojima,M. et al. Bulletin of the Chemical Society of Japan, 1973 , vol. 46, p. 1254 - 1256 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Tetrabutylammonium benzoate |
| n,n,n-triethylethanaminium benzoate |
| benzoic acid tetraethylammonium salt |
| tetraethylazanium benzoate |
| EINECS 240-957-3 |
| Tetraethylammonium benzoate |
| Tetraethylammoniumbenzoat |
| Et4N benzoate |
| (Et4N)(O2CPh) |