Methyl perfluoro-3,6,9-trioxadecanoate structure
|
Common Name | Methyl perfluoro-3,6,9-trioxadecanoate | ||
|---|---|---|---|---|
| CAS Number | 169289-58-1 | Molecular Weight | 426.08600 | |
| Density | 1.675g/cm3 | Boiling Point | 226.5ºC at 760mmHg | |
| Molecular Formula | C8H3F13O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 88.4ºC | |
| Name | Methyl perfluoro-3,6,9-trioxadecanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.675g/cm3 |
|---|---|
| Boiling Point | 226.5ºC at 760mmHg |
| Molecular Formula | C8H3F13O5 |
| Molecular Weight | 426.08600 |
| Flash Point | 88.4ºC |
| Exact Mass | 425.97700 |
| PSA | 53.99000 |
| LogP | 3.69300 |
| Vapour Pressure | 0.0814mmHg at 25°C |
| Index of Refraction | 1.303 |
| InChIKey | USFGKFMVGHXGNG-UHFFFAOYSA-N |
| SMILES | COC(=O)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)F |
| Hazard Codes | F: Flammable;Xi: Irritant; |
|---|---|
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| methyl 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]acetate |