Boc-DL-3-Aminoisobutyric acid structure
|
Common Name | Boc-DL-3-Aminoisobutyric acid | ||
|---|---|---|---|---|
| CAS Number | 16948-10-0 | Molecular Weight | 203.236 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 339.5±25.0 °C at 760 mmHg | |
| Molecular Formula | C9H17NO4 | Melting Point | 89-90℃ (ethyl ether pentane ) | |
| MSDS | N/A | Flash Point | 159.1±23.2 °C | |
| Name | 2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 339.5±25.0 °C at 760 mmHg |
| Melting Point | 89-90℃ (ethyl ether pentane ) |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.236 |
| Flash Point | 159.1±23.2 °C |
| Exact Mass | 203.115753 |
| PSA | 75.63000 |
| LogP | 1.27 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.461 |
| InChIKey | GDQRNRYMFXDGMS-UHFFFAOYSA-N |
| SMILES | CC(CNC(=O)OC(C)(C)C)C(=O)O |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924199090 |
|
~97%
Boc-DL-3-Aminoi... CAS#:16948-10-0 |
| Literature: Journal of Organic Chemistry, , vol. 66, # 20 p. 6541 - 6544 |
|
~73%
Boc-DL-3-Aminoi... CAS#:16948-10-0 |
| Literature: US6372936 B1, ; Page column 4 ; |
|
~%
Boc-DL-3-Aminoi... CAS#:16948-10-0 |
| Literature: Journal of the Chemical Society [Section] C: Organic, , p. 2632 - 2636 |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid |
| 2-methyl-3-(tert-butyloxycarbonylamino)propionic acid |
| 3-(Tert-butoxycarbonylamino)-2-methylpropionic acid |
| 3-[(tert-Butoxycarbonyl)amino]-2-methylpropanoic acid |
| N-tert-butoxycarbonyl-3-amino-2(RS)-methylpropionic acid |
| 3-tert-Butoxycarbonylamino-2-methyl-propionic acid |
| Boc-DL-3-Aminoisobutyric acid |
| (3R)-methyl-3-(tert-butoxycarbonyl)aminopropanoic acid |
| Propanoic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-2-methyl- |
| 2-methyl-3-[(tert-butoxy)carbonylamino]propanoic acid |