3,5-dichloro-4-hydroxy-acetophenone structure
|
Common Name | 3,5-dichloro-4-hydroxy-acetophenone | ||
|---|---|---|---|---|
| CAS Number | 17044-70-1 | Molecular Weight | 205.038 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 335.5±42.0 °C at 760 mmHg | |
| Molecular Formula | C8H6Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.7±27.9 °C | |
| Name | 1-(3,5-dichloro-4-hydroxyphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 335.5±42.0 °C at 760 mmHg |
| Molecular Formula | C8H6Cl2O2 |
| Molecular Weight | 205.038 |
| Flash Point | 156.7±27.9 °C |
| Exact Mass | 203.974487 |
| PSA | 37.30000 |
| LogP | 3.05 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.584 |
| InChIKey | FXSIZYWHUQEXPC-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc(Cl)c(O)c(Cl)c1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 3,5-dichloro-4-hydroxy-acetophenone |
| EINECS 241-113-7 |
| Ethanone, 1-(3,5-dichloro-4-hydroxyphenyl)- |
| 4-hydroxy-3,5-dichloroacetophenone |
| 1-(3,5-Dichloro-4-hydroxyphenyl)ethanone |
| 3',5'-DICHLORO-4'-HYDROXYACETOPHENONE |
| 1-(3,5-Dichlor-4-hydroxy-phenyl)-aethanon |
| 1-(3,5-dichloro-4-hydroxy-phenyl)-ethanone |
| 2,6-dichloro-4-acetylphenol |
| 2,6-dichloro-4-methylcarbonylphenol |