3,5-Dichloro-4-hydroxybenzoic acid structure
|
Common Name | 3,5-Dichloro-4-hydroxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 3336-41-2 | Molecular Weight | 207.011 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 328.2±42.0 °C at 760 mmHg | |
| Molecular Formula | C7H4Cl2O3 | Melting Point | 264-266 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 152.3±27.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3,5-Dichloro-4-hydroxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 328.2±42.0 °C at 760 mmHg |
| Melting Point | 264-266 °C(lit.) |
| Molecular Formula | C7H4Cl2O3 |
| Molecular Weight | 207.011 |
| Flash Point | 152.3±27.9 °C |
| Exact Mass | 205.953751 |
| PSA | 57.53000 |
| LogP | 3.37 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | AULKDLUOQCUNOK-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(Cl)c(O)c(Cl)c1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | DG7502000 |
| HS Code | 2918290000 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
|
Study of Cytotoxic Effects of Benzonitrile Pesticides.
Biomed Res. Int. 2015 , 381264, (2015) The benzonitrile herbicides bromoxynil, chloroxynil, dichlobenil, and ioxynil have been used actively worldwide to control weeds in agriculture since 1970s. Even though dichlobenil is prohibited in EU... |
|
|
Potent human uric acid transporter 1 inhibitors: in vitro and in vivo metabolism and pharmacokinetic studies.
Drug Des. Devel. Ther. 6 , 323-39, (2012) Human uric acid transporter 1 (hURAT1; SLC22A12) is a very important urate anion exchanger. Elevated urate levels are known to play a pivotal role in cardiovascular diseases, chronic renal disease, di... |
|
|
Preparation and Characterization of a Polyclonal Antibody against Brominated Protein.
J. Clin. Biochem. Nutr. 44 , 95-103, (2009) (Di)bromotyrosine is formed by the specific reaction of eosinophil peroxidase and can be used as an eosinophil activation marker. In the present study, an antibody for (di)bromotyrosine in proteins wa... |
| 4-hydroxy-3,5-dichloro-benzoic acid |
| BENZOIC ACID,3,5-DICHLORO-4-HYDROXY |
| acide dichloro-3,5 hydroxy-4 benzoique |
| DiClHBz |
| 3,5-Dichloro-4-hydroxybenzoic acid |
| EINECS 222-071-9 |
| 3,5-dichloro-4-hydroxy-benzoic acid |
| Benzoic acid, 3,5-dichloro-4-hydroxy- |
| 3,5-Dichloro-4-hydroxybenzoicAcid |
| 3,5-Dichlor-4-hydroxy-benzoesaeure |
| MFCD00002550 |