(Chloromethyl)(triphenyl)silane structure
|
Common Name | (Chloromethyl)(triphenyl)silane | ||
|---|---|---|---|---|
| CAS Number | 17067-65-1 | Molecular Weight | 308.877 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 380.0±34.0 °C at 760 mmHg | |
| Molecular Formula | C19H17ClSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.7±11.0 °C | |
| Name | chloromethyl(triphenyl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 380.0±34.0 °C at 760 mmHg |
| Molecular Formula | C19H17ClSi |
| Molecular Weight | 308.877 |
| Flash Point | 204.7±11.0 °C |
| Exact Mass | 308.078796 |
| LogP | 6.66 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | TWLQFXVRXFUAMZ-UHFFFAOYSA-N |
| SMILES | ClC[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
|
~32%
(Chloromethyl)(... CAS#:17067-65-1 |
| Literature: Hu, Chunye; He, Ji-Gang; O'Brien, D. H.; Irgolic, K. J. Journal of Organometallic Chemistry, 1984 , vol. 268, # 1 p. 31 - 38 |
|
~%
(Chloromethyl)(... CAS#:17067-65-1 |
| Literature: Seyferth,D.; Hopper,S.P. Journal of Organometallic Chemistry, 1970 , vol. 23, p. 99 - 104 |
| Precursor 4 | |
|---|---|
| DownStream 9 | |
| Benzene, 1,1',1''-[(chloromethyl)silylidyne]tris- |
| Chlormethyl-triphenyl-silan |
| (Chloromethyl)(triphenyl)silane |