Difluoro(diphenyl)silane structure
|
Common Name | Difluoro(diphenyl)silane | ||
|---|---|---|---|---|
| CAS Number | 312-40-3 | Molecular Weight | 220.290 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 252.0±9.0 °C at 760 mmHg | |
| Molecular Formula | C12H10F2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 106.2±18.7 °C | |
| Name | difluoro(diphenyl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 252.0±9.0 °C at 760 mmHg |
| Molecular Formula | C12H10F2Si |
| Molecular Weight | 220.290 |
| Flash Point | 106.2±18.7 °C |
| Exact Mass | 220.051987 |
| LogP | 6.16 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | BOMPXIHODLVNMC-UHFFFAOYSA-N |
| SMILES | F[Si](F)(c1ccccc1)c1ccccc1 |
| Hazard Codes | C: Corrosive; |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 1760 |
| HS Code | 2931900090 |
| Precursor 5 | |
|---|---|
| DownStream 9 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Silane,difluorodiphenyl |
| EINECS 206-226-8 |
| Benzene, 1,1'-(difluorosilylene)bis- |
| Difluoro(diphenyl)silane |
| diphenylsilyldifluoride |
| Diphenyldifluorosilane |
| diphenyldifluororosilane |
| Diphenylsilane difluoride |
| MFCD00017898 |
| Difluorodiphenylsilane |