Dihydrodaidzein structure
|
Common Name | Dihydrodaidzein | ||
|---|---|---|---|---|
| CAS Number | 17238-05-0 | Molecular Weight | 256.253 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 529.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C15H12O4 | Melting Point | 250-251ºC | |
| MSDS | N/A | Flash Point | 206.9±23.6 °C | |
Use of DihydrodaidzeinDihydrodaidzein is one of the most prominent dietary phytoestrogens. |
| Name | dihydrodaidzein |
|---|---|
| Synonym | More Synonyms |
| Description | Dihydrodaidzein is one of the most prominent dietary phytoestrogens. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 529.5±50.0 °C at 760 mmHg |
| Melting Point | 250-251ºC |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.253 |
| Flash Point | 206.9±23.6 °C |
| Exact Mass | 256.073547 |
| PSA | 66.76000 |
| LogP | 2.79 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.662 |
| InChIKey | JHYXBPPMXZIHKG-UHFFFAOYSA-N |
| SMILES | O=C1c2ccc(O)cc2OCC1c1ccc(O)cc1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-Hydroxy-3-(4-hydroxyphenyl)-2,3-dihydro-4H-chromen-4-one |
| 7-Hydroxy-3-(4-hydroxyphenyl)chroman-4-one |
| Dihydro Daidzein |
| dihydrodaizein |
| 7-Hydroxy-3-(4-hydroxyphenyl)-4-chromanone |
| 4H-1-Benzopyran-4-one, 2,3-dihydro-7-hydroxy-3-(4-hydroxyphenyl)- |
| 7,4'-Dihydroxyisoflavanone |
| 4',7-Dihydroxyisoflavanone |
| 7-hydroxy-3-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one |