Ethanethioic acid,S-(triphenylmethyl) ester structure
|
Common Name | Ethanethioic acid,S-(triphenylmethyl) ester | ||
|---|---|---|---|---|
| CAS Number | 1727-15-7 | Molecular Weight | 318.43200 | |
| Density | 1.15g/cm3 | Boiling Point | 433.5ºC at 760mmHg | |
| Molecular Formula | C21H18OS | Melting Point | 141-144ºC(lit.) | |
| MSDS | USA | Flash Point | 184.4ºC | |
| Name | triphenylmethanethiol acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 433.5ºC at 760mmHg |
| Melting Point | 141-144ºC(lit.) |
| Molecular Formula | C21H18OS |
| Molecular Weight | 318.43200 |
| Flash Point | 184.4ºC |
| Exact Mass | 318.10800 |
| PSA | 42.37000 |
| LogP | 5.25820 |
| Vapour Pressure | 1.02E-07mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | GUGBTNQSFAFZSY-UHFFFAOYSA-N |
| SMILES | CC(=O)SC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | UN3335 9 |
| WGK Germany | 3 |
| HS Code | 2930909090 |
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Structure-activity relationship of S-trityl-L-cysteine analogues as inhibitors of the human mitotic kinesin Eg5.
J. Med. Chem. 51 , 1115-25, (2008) The human kinesin Eg5 is a potential drug target for cancer chemotherapy. Eg5 specific inhibitors cause cells to block in mitosis with a characteristic monoastral spindle phenotype. Prolonged metaphas... |
| Triphenylmethyl-acetyl-sulfid |
| MFCD00053709 |
| Acetylmercapto-triphenyl-methan |
| thioacetic acid S-trityl ester |
| S-Trityl-thioacetat |
| Thioessigsaeure-S-triphenylmethylester |
| S-Triphenylmethyl-thioacetat |
| Trityl thioacetate |
| Thioessigsaeure-S-tritylester |
| TRIPHENYLMETHYL THIOLACETATE |