(-)-EGC-4'-O-ME structure
|
Common Name | (-)-EGC-4'-O-ME | ||
|---|---|---|---|---|
| CAS Number | 17291-05-3 | Molecular Weight | 320.29400 | |
| Density | 1.553g/cm3 | Boiling Point | 646.1ºC at 760mmHg | |
| Molecular Formula | C16H16O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 344.5ºC | |
| Name | (-)-egc-4'-o-me |
|---|---|
| Synonym | More Synonyms |
| Density | 1.553g/cm3 |
|---|---|
| Boiling Point | 646.1ºC at 760mmHg |
| Molecular Formula | C16H16O7 |
| Molecular Weight | 320.29400 |
| Flash Point | 344.5ºC |
| Exact Mass | 320.09000 |
| PSA | 119.61000 |
| LogP | 1.55470 |
| Vapour Pressure | 1.41E-17mmHg at 25°C |
| Index of Refraction | 1.706 |
| InChIKey | ITDYPNOEEHONAH-UKRRQHHQSA-N |
| SMILES | COc1c(O)cc(C2Oc3cc(O)cc(O)c3CC2O)cc1O |
| HS Code | 2932999099 |
|---|
|
~%
(-)-EGC-4'-O-ME CAS#:17291-05-3 |
| Literature: Okushio; Suzuki; Matsumoto; Nanjo; Hara Bioscience, biotechnology, and biochemistry, 1999 , vol. 63, # 2 p. 430 - 432 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4'-O-methyl-epigallocatechin |