S-adenosylmethionine
S-adenosylmethionine structure
|
Common Name | S-adenosylmethionine | ||
|---|---|---|---|---|
| CAS Number | 485-80-3 | Molecular Weight | 399.44500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H23N6O5S+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 13ch3-sam |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H23N6O5S+ |
|---|---|
| Molecular Weight | 399.44500 |
| Exact Mass | 399.14500 |
| PSA | 207.93000 |
| InChIKey | MEFKEPWMEQBLKI-AIRLBKTGSA-O |
| SMILES | C[S+](CCC(N)C(=O)O)CC1OC(n2cnc3c(N)ncnc32)C(O)C1O |
| Storage condition | -20°C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 10 | |
CAS#:108907-44-4
CAS#:121-33-5
CAS#:63-68-3
CAS#:731-98-6![[18f]fda structure](https://image.chemsrc.com/caspic/120/302599-69-5.png)
CAS#:302599-69-5
CAS#:701-57-5![1-[(p-Nitrophenyl)thio]-2-propanone structure](https://image.chemsrc.com/caspic/285/25784-85-4.png)
CAS#:25784-85-4
CAS#:1912-33-0
CAS#:979-92-0
CAS#:23452-05-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| S-adenosylmethionine |
| S-ADENOSYL-L-METHIONINE |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 13ch3-sam? |
| A: Polar surface area (PSA) of 13ch3-sam is 207.93000. |
| Q: What is the InChIKey of 13ch3-sam? |
| A: InChIKey of 13ch3-sam is MEFKEPWMEQBLKI-AIRLBKTGSA-O. |
| Q: What is the CAS number of 13ch3-sam? |
| A: CAS number of 13ch3-sam is 485-80-3. |
| Q: What are the downstream products of 13ch3-sam? |
| A: Related downstream products(CAS) of 13ch3-sam: 108907-44-4;121-33-5;63-68-3;731-98-6;302599-69-5;701-57-5;25784-85-4;1912-33-0;979-92-0;23452-05-3. |
| Q: What is the molecular formula of 13ch3-sam? |
| A: Molecular formula of 13ch3-sam is C15H23N6O5S+. |
| Q: What is the SMILES notation of 13ch3-sam? |
| A: SMILES notation of 13ch3-sam is C[S+](CCC(N)C(=O)O)CC1OC(n2cnc3c(N)ncnc32)C(O)C1O. |
| Q: What is the molecular weight of 13ch3-sam? |
| A: Molecular weight of 13ch3-sam is 399.44500. |
| Q: What is the English name of 13ch3-sam? |
| A: The English name of 13ch3-sam is 13ch3-sam. |
| Q: What English synonyms does 13ch3-sam have? |
| A: English synonyms of 13ch3-sam: S-adenosylmethionine, S-ADENOSYL-L-METHIONINE. |
| Q: What are the storage conditions for 13ch3-sam? |
| A: Storage conditions for 13ch3-sam: -20°C. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |
| Henan Tianfu Chemical Co., Ltd. |